Retigeric acid B

Retigeric acid B
Names
	IUPAC name 2α,3β-Dihydroxy-13,17-dimethyl-26,28-dinor-8α,13α,14β,17α,18β-hopane-23,25-dicarboxylic acid
	Systematic IUPAC name (3R,3aR,5aR,5bR,7aR,8S,9R,10R,11aR,13aS,13bR)-9,10-Dihydroxy-3a,5a,8,13a-tetramethyl-3-(propan-2-yl)-1,2,3,3a,4,5,5a,5b,6,7,7a,8,9,10,11,13,13a,13b-octadecahydro-11aH-cyclopenta[a]chrysene-8,11a-dicarboxylic acid
Identifiers
CAS Number	38327-77-4;
3D model (JSmol)	Interactive image;
PubChem CID	53319374;
UNII	5M66ARA2BR ;
	SMILES CC(C)[C@H]1CC[C@@H]2[C@@]1(CC[C@]3([C@]2(CC=C4[C@@H]3CC[C@@H]5[C@@]4(C[C@H]([C@@H]([C@@]5(C)C(=O)O)O)O)C(=O)O)C)C)C;
Properties
Chemical formula	C30H46O6
Molar mass	502.692 g·mol−1
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Retigeric acid B is a hopanoids chemical compound isolated from Lobaria.^[1]^[2]

References[edit]

^ Zhang HJ, Ou Y, Lou HX (June 2007). "[Studies on chemical constituents of Lobaria kurokawae yoshim]". Zhong Yao Cai (in Chinese). 30 (6): 651–5. PMID 17918430.
^ Liu H, Liu YQ, Liu YQ, et al. (December 2010). "A novel anticancer agent, retigeric acid B, displays proliferation inhibition, S phase arrest and apoptosis activation in human prostate cancer cells". Chemico-Biological Interactions. 188 (3): 598–606. doi:10.1016/j.cbi.2010.07.024. PMID 20692244.

This article about an organic compound is a stub. You can help Wikipedia by expanding it.